C13H16O2 — CID 90322673
cis-(1S,2S)-1-methyl-2-(phenylmethoxymethyl)cyclopropane-1-carbaldehyde (PubChem CID 90322673) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is cis-(1S,2S)-1-methyl-2-(phenylmethoxymethyl)cyclopropane-1-carbaldehyde.
| Compound Name | cis-(1S,2S)-1-methyl-2-(phenylmethoxymethyl)cyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 90322673 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | cis-(1S,2S)-1-methyl-2-(phenylmethoxymethyl)cyclopropane-1-carbaldehyde |
| SMILES | C[C@]1(C=O)C[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C13H16O2/c1-13(10-14)7-12(13)9-15-8-11-5-3-2-4-6-11/h2-6,10,12H,7-9H2,1H3/t12-,13-/m1/s1 |
| InChIKey | RHJIUUOGIBGRPO-CHWSQXEVSA-N |
| XLogP | 2.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|