C12H23BO2 — CID 90322736
2-[(E)-hex-4-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 90322736) has the molecular formula C12H23BO2 and a molecular weight of 210.13 g/mol. Its IUPAC name is 2-[(E)-hex-4-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(E)-hex-4-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 90322736 |
| Molecular Formula | C12H23BO2 |
| Molecular Weight | 210.13 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | 2-[(E)-hex-4-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C/C=C/CCCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C12H23BO2/c1-6-7-8-9-10-13-14-11(2,3)12(4,5)15-13/h6-7H,8-10H2,1-5H3/b7-6+ |
| InChIKey | PJVCETQHKUYBSH-VOTSOKGWSA-N |
| XLogP | 3.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.13 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|