C18H18O4 — CID 90322823
3-hydroxy-1,4,7,9,10-pentamethylbenzo[b][1,4]benzodioxepin-6-one (PubChem CID 90322823) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 3-hydroxy-1,4,7,9,10-pentamethylbenzo[b][1,4]benzodioxepin-6-one.
| Compound Name | 3-hydroxy-1,4,7,9,10-pentamethylbenzo[b][1,4]benzodioxepin-6-one |
|---|---|
| PubChem CID | 90322823 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 3-hydroxy-1,4,7,9,10-pentamethylbenzo[b][1,4]benzodioxepin-6-one |
| SMILES | Cc1cc(C)c2c(c1C)Oc1c(C)cc(O)c(C)c1OC2=O |
| InChI | InChI=1S/C18H18O4/c1-8-6-9(2)14-16(11(8)4)21-15-10(3)7-13(19)12(5)17(15)22-18(14)20/h6-7,19H,1-5H3 |
| InChIKey | YCRDKLGDZWFNAD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|