C29H52O6SSi2 — CID 90322833
2-[(2S,3R,4R,5R)-3-(benzenesulfonylmethyl)-5-[2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methyloxolan-2-yl]acetaldehyde (PubChem CID 90322833) has the molecular formula C29H52O6SSi2 and a molecular weight of 584.97 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5R)-3-(benzenesulfonylmethyl)-5-[2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methyloxolan-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,3R,4R,5R)-3-(benzenesulfonylmethyl)-5-[2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methyloxolan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 90322833 |
| Molecular Formula | C29H52O6SSi2 |
| Molecular Weight | 584.97 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | 2-[(2S,3R,4R,5R)-3-(benzenesulfonylmethyl)-5-[2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methyloxolan-2-yl]acetaldehyde |
| SMILES | C[C@@H]1[C@@H](CS(=O)(=O)c2ccccc2)[C@H](CC=O)O[C@@H]1CC(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H52O6SSi2/c1-22-25(21-36(31,32)24-15-13-12-14-16-24)26(17-18-30)34-27(22)19-23(35-38(10,11)29(5,6)7)20-33-37(8,9)28(2,3)4/h12-16,18,22-23,25-27H,17,19-21H2,1-11H3/t22-,23?,25-,26+,27-/m1/s1 |
| InChIKey | TYRUWNREUTUALQ-XTNSLXBCSA-N |
| XLogP | 6.87 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.97 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|