C28H30N6O7S2 — CID 90323434
5-amino-2-[[2-pentanoyloxy-5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoyl]amino]-5-sulfanylidenepentanoic acid (PubChem CID 90323434) has the molecular formula C28H30N6O7S2 and a molecular weight of 626.72 g/mol. Its IUPAC name is 5-amino-2-[[2-pentanoyloxy-5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoyl]amino]-5-sulfanylidenepentanoic acid.
| Compound Name | 5-amino-2-[[2-pentanoyloxy-5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoyl]amino]-5-sulfanylidenepentanoic acid |
|---|---|
| PubChem CID | 90323434 |
| Molecular Formula | C28H30N6O7S2 |
| Molecular Weight | 626.72 g/mol |
| Exact Mass | 626.16 |
| IUPAC Name | 5-amino-2-[[2-pentanoyloxy-5-[[4-(pyridin-2-ylsulfamoyl)phenyl]diazenyl]benzoyl]amino]-5-sulfanylidenepentanoic acid |
| SMILES | CCCCC(=O)Oc1ccc(/N=N/c2ccc(S(=O)(=O)Nc3ccccn3)cc2)cc1C(=O)NC(CCC(N)=S)C(=O)O |
| InChI | InChI=1S/C28H30N6O7S2/c1-2-3-7-26(35)41-23-14-10-19(17-21(23)27(36)31-22(28(37)38)13-15-24(29)42)33-32-18-8-11-20(12-9-18)43(39,40)34-25-6-4-5-16-30-25/h4-6,8-12,14,16-17,22H,2-3,7,13,15H2,1H3,(H2,29,42)(H,30,34)(H,31,36)(H,37,38)/b33-32+ |
| InChIKey | FUFCYFCULSOZCQ-ULIFNZDWSA-N |
| XLogP | 4.64 |
| TPSA | 202.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.72 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|