C34H32FN5O4 — CID 90323865
N-benzoyl-N-[9-[(2R,3R,4R,5R)-5-ethyl-3-fluoro-3,4-dimethyloxolan-2-yl]-6-phenylmethoxypurin-2-yl]benzamide (PubChem CID 90323865) has the molecular formula C34H32FN5O4 and a molecular weight of 593.66 g/mol. Its IUPAC name is N-benzoyl-N-[9-[(2R,3R,4R,5R)-5-ethyl-3-fluoro-3,4-dimethyloxolan-2-yl]-6-phenylmethoxypurin-2-yl]benzamide.
| Compound Name | N-benzoyl-N-[9-[(2R,3R,4R,5R)-5-ethyl-3-fluoro-3,4-dimethyloxolan-2-yl]-6-phenylmethoxypurin-2-yl]benzamide |
|---|---|
| PubChem CID | 90323865 |
| Molecular Formula | C34H32FN5O4 |
| Molecular Weight | 593.66 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | N-benzoyl-N-[9-[(2R,3R,4R,5R)-5-ethyl-3-fluoro-3,4-dimethyloxolan-2-yl]-6-phenylmethoxypurin-2-yl]benzamide |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(OCc4ccccc4)nc(N(C(=O)c4ccccc4)C(=O)c4ccccc4)nc32)[C@](C)(F)[C@@H]1C |
| InChI | InChI=1S/C34H32FN5O4/c1-4-26-22(2)34(3,35)32(44-26)39-21-36-27-28(39)37-33(38-29(27)43-20-23-14-8-5-9-15-23)40(30(41)24-16-10-6-11-17-24)31(42)25-18-12-7-13-19-25/h5-19,21-22,26,32H,4,20H2,1-3H3/t22-,26-,32-,34-/m1/s1 |
| InChIKey | ZUFBOPQHZFHNNB-YBQKWDGTSA-N |
| XLogP | 6.56 |
| TPSA | 99.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.66 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|