C16H30N2O2 — CID 90324188
N-[(1R,2R,6S)-4-ethyl-6-(methylamino)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide (PubChem CID 90324188) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N-[(1R,2R,6S)-4-ethyl-6-(methylamino)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide.
| Compound Name | N-[(1R,2R,6S)-4-ethyl-6-(methylamino)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 90324188 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | N-[(1R,2R,6S)-4-ethyl-6-(methylamino)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide |
| SMILES | CCC1=C[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](NC)C1 |
| InChI | InChI=1S/C16H30N2O2/c1-6-12-9-14(17-5)16(18-11(4)19)15(10-12)20-13(7-2)8-3/h10,13-17H,6-9H2,1-5H3,(H,18,19)/t14-,15+,16+/m0/s1 |
| InChIKey | FMJWTLXGTZBOQH-ARFHVFGLSA-N |
| XLogP | 2.39 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|