C40H52O4S4 — CID 90324252
4,9-bis(5-nonylthiophen-2-yl)-13,16,17,20-tetraoxa-5,8-dithiapentacyclo[10.4.4.01,12.02,6.07,11]icosa-2(6),3,7(11),9-tetraene (PubChem CID 90324252) has the molecular formula C40H52O4S4 and a molecular weight of 725.12 g/mol. Its IUPAC name is 4,9-bis(5-nonylthiophen-2-yl)-13,16,17,20-tetraoxa-5,8-dithiapentacyclo[10.4.4.01,12.02,6.07,11]icosa-2(6),3,7(11),9-tetraene.
| Compound Name | 4,9-bis(5-nonylthiophen-2-yl)-13,16,17,20-tetraoxa-5,8-dithiapentacyclo[10.4.4.01,12.02,6.07,11]icosa-2(6),3,7(11),9-tetraene |
|---|---|
| PubChem CID | 90324252 |
| Molecular Formula | C40H52O4S4 |
| Molecular Weight | 725.12 g/mol |
| Exact Mass | 724.27 |
| IUPAC Name | 4,9-bis(5-nonylthiophen-2-yl)-13,16,17,20-tetraoxa-5,8-dithiapentacyclo[10.4.4.01,12.02,6.07,11]icosa-2(6),3,7(11),9-tetraene |
| SMILES | CCCCCCCCCc1ccc(-c2cc3c(s2)-c2sc(-c4ccc(CCCCCCCCC)s4)cc2C24OCCOC32OCCO4)s1 |
| InChI | InChI=1S/C40H52O4S4/c1-3-5-7-9-11-13-15-17-29-19-21-33(45-29)35-27-31-37(47-35)38-32(40-39(31,41-23-25-43-40)42-24-26-44-40)28-36(48-38)34-22-20-30(46-34)18-16-14-12-10-8-6-4-2/h19-22,27-28H,3-18,23-26H2,1-2H3 |
| InChIKey | BCDAUSXHKLGLQH-UHFFFAOYSA-N |
| XLogP | 12.93 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.12 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|