C29H15F5O5S4 — CID 90324258
(2,3,4,5,6-pentafluorophenyl)-[5-(9-thiophen-2-yl-13,16,17,20-tetraoxa-5,8-dithiapentacyclo[10.4.4.01,12.02,6.07,11]icosa-2(6),3,7(11),9-tetraen-4-yl)thiophen-2-yl]methanone (PubChem CID 90324258) has the molecular formula C29H15F5O5S4 and a molecular weight of 666.69 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)-[5-(9-thiophen-2-yl-13,16,17,20-tetraoxa-5,8-dithiapentacyclo[10.4.4.01,12.02,6.07,11]icosa-2(6),3,7(11),9-tetraen-4-yl)thiophen-2-yl]methanone.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)-[5-(9-thiophen-2-yl-13,16,17,20-tetraoxa-5,8-dithiapentacyclo[10.4.4.01,12.02,6.07,11]icosa-2(6),3,7(11),9-tetraen-4-yl)thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 90324258 |
| Molecular Formula | C29H15F5O5S4 |
| Molecular Weight | 666.69 g/mol |
| Exact Mass | 665.97 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)-[5-(9-thiophen-2-yl-13,16,17,20-tetraoxa-5,8-dithiapentacyclo[10.4.4.01,12.02,6.07,11]icosa-2(6),3,7(11),9-tetraen-4-yl)thiophen-2-yl]methanone |
| SMILES | O=C(c1ccc(-c2cc3c(s2)-c2sc(-c4cccs4)cc2C24OCCOC32OCCO4)s1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C29H15F5O5S4/c30-20-19(21(31)23(33)24(34)22(20)32)25(35)16-4-3-15(41-16)18-11-13-27(43-18)26-12(10-17(42-26)14-2-1-9-40-14)28-29(13,38-7-5-36-28)39-8-6-37-28/h1-4,9-11H,5-8H2 |
| InChIKey | KRIOODOCORRPFC-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.69 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|