About 3-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]-N,N-dimethylpropan-1-amine
3-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]-N,N-dimethylpropan-1-amine (PubChem CID 90324337) has the molecular formula C12H17BFNO2
and a molecular weight of 237.08 g/mol. Its IUPAC name is 3-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]-N,N-dimethylpropan-1-amine |
| PubChem CID | 90324337 |
| Molecular Formula | C12H17BFNO2 |
| Molecular Weight | 237.08 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 3-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOB1OCc2cc(F)ccc21 |
| InChI | InChI=1S/C12H17BFNO2/c1-15(2)6-3-7-16-13-12-5-4-11(14)8-10(12)9-17-13/h4-5,8H,3,6-7,9H2,1-2H3 |
| InChIKey | LRYUYJDLKWGNIZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.08 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]-N,N-dimethylpropan-1-amine (CID 90324337) is 3-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]-N,N-dimethylpropan-1-amine is CN(C)CCCOB1OCc2cc(F)ccc21.
What is the InChIKey of 3-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]-N,N-dimethylpropan-1-amine?
The InChIKey is LRYUYJDLKWGNIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BFNO2/c1-15(2)6-3-7-16-13-12-5-4-11(14)8-10(12)9-17-13/h4-5,8H,3,6-7,9H2,1-2H3.
What are the key properties of 3-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]-N,N-dimethylpropan-1-amine?
3-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]-N,N-dimethylpropan-1-amine has a molecular weight of 237.08 g/mol, XLogP of 1.02, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-fluoro-3H-2,1-benzoxaborol-1-yl)oxy]-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 90324337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).