C27H44O2 — CID 90324885
3-ethyl-3-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]pentan-2-one (PubChem CID 90324885) has the molecular formula C27H44O2 and a molecular weight of 400.65 g/mol. Its IUPAC name is 3-ethyl-3-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]pentan-2-one.
| Compound Name | 3-ethyl-3-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]pentan-2-one |
|---|---|
| PubChem CID | 90324885 |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | 3-ethyl-3-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]pentan-2-one |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCOC(CC)(CC)C(C)=O |
| InChI | InChI=1S/C27H44O2/c1-5-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-29-27(6-2,7-3)26(4)28/h8-9,11-12,14-15,17-18,20-21H,5-7,10,13,16,19,22-25H2,1-4H3/b9-8-,12-11-,15-14-,18-17-,21-20- |
| InChIKey | JYUXMHOEPWOCLZ-QXPWYRSVSA-N |
| XLogP | 8.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|