C28H29F3N6O3 — CID 90325071
6-[[(1R)-1-cyclobutylethyl]amino]-8-[[(1R)-2-hydroxy-1-phenylethyl]amino]-7-[[4-(trifluoromethyl)phenyl]methyl]purine-2-carboxylic acid (PubChem CID 90325071) has the molecular formula C28H29F3N6O3 and a molecular weight of 554.57 g/mol. Its IUPAC name is 6-[[(1R)-1-cyclobutylethyl]amino]-8-[[(1R)-2-hydroxy-1-phenylethyl]amino]-7-[[4-(trifluoromethyl)phenyl]methyl]purine-2-carboxylic acid.
| Compound Name | 6-[[(1R)-1-cyclobutylethyl]amino]-8-[[(1R)-2-hydroxy-1-phenylethyl]amino]-7-[[4-(trifluoromethyl)phenyl]methyl]purine-2-carboxylic acid |
|---|---|
| PubChem CID | 90325071 |
| Molecular Formula | C28H29F3N6O3 |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | 6-[[(1R)-1-cyclobutylethyl]amino]-8-[[(1R)-2-hydroxy-1-phenylethyl]amino]-7-[[4-(trifluoromethyl)phenyl]methyl]purine-2-carboxylic acid |
| SMILES | C[C@@H](Nc1nc(C(=O)O)nc2nc(N[C@@H](CO)c3ccccc3)n(Cc3ccc(C(F)(F)F)cc3)c12)C1CCC1 |
| InChI | InChI=1S/C28H29F3N6O3/c1-16(18-8-5-9-18)32-23-22-24(35-25(34-23)26(39)40)36-27(33-21(15-38)19-6-3-2-4-7-19)37(22)14-17-10-12-20(13-11-17)28(29,30)31/h2-4,6-7,10-13,16,18,21,38H,5,8-9,14-15H2,1H3,(H,39,40)(H2,32,33,34,35,36)/t16-,21+/m1/s1 |
| InChIKey | VUCORYCZTBOMBO-IERDGZPVSA-N |
| XLogP | 5.34 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |