C29H42N8O3 — CID 90325077
5-[8-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]purin-2-yl]-3H-1,3,4-oxadiazol-2-one (PubChem CID 90325077) has the molecular formula C29H42N8O3 and a molecular weight of 550.71 g/mol. Its IUPAC name is 5-[8-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]purin-2-yl]-3H-1,3,4-oxadiazol-2-one.
| Compound Name | 5-[8-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]purin-2-yl]-3H-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 90325077 |
| Molecular Formula | C29H42N8O3 |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.34 |
| IUPAC Name | 5-[8-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]purin-2-yl]-3H-1,3,4-oxadiazol-2-one |
| SMILES | CC1CCC(Cn2c(N3CCOC4CCCCC43)nc3nc(-c4n[nH]c(=O)o4)nc(N[C@H](C)C4CCC4)c32)CC1 |
| InChI | InChI=1S/C29H42N8O3/c1-17-10-12-19(13-11-17)16-37-23-24(30-18(2)20-6-5-7-20)31-26(27-34-35-29(38)40-27)32-25(23)33-28(37)36-14-15-39-22-9-4-3-8-21(22)36/h17-22H,3-16H2,1-2H3,(H,35,38)(H,30,31,32)/t17?,18-,19?,21?,22?/m1/s1 |
| InChIKey | PEXHJBUQRMZUIW-NDJSSQOBSA-N |
| XLogP | 4.74 |
| TPSA | 126.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |