C30H41N7O2 — CID 90325252
6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]-8-(2-pyridin-3-ylpiperidin-1-yl)purine-2-carboxylic acid (PubChem CID 90325252) has the molecular formula C30H41N7O2 and a molecular weight of 531.71 g/mol. Its IUPAC name is 6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]-8-(2-pyridin-3-ylpiperidin-1-yl)purine-2-carboxylic acid.
| Compound Name | 6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]-8-(2-pyridin-3-ylpiperidin-1-yl)purine-2-carboxylic acid |
|---|---|
| PubChem CID | 90325252 |
| Molecular Formula | C30H41N7O2 |
| Molecular Weight | 531.71 g/mol |
| Exact Mass | 531.33 |
| IUPAC Name | 6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]-8-(2-pyridin-3-ylpiperidin-1-yl)purine-2-carboxylic acid |
| SMILES | CC1CCC(Cn2c(N3CCCCC3c3cccnc3)nc3nc(C(=O)O)nc(N[C@H](C)C4CCC4)c32)CC1 |
| InChI | InChI=1S/C30H41N7O2/c1-19-11-13-21(14-12-19)18-37-25-26(32-20(2)22-7-5-8-22)33-28(29(38)39)34-27(25)35-30(37)36-16-4-3-10-24(36)23-9-6-15-31-17-23/h6,9,15,17,19-22,24H,3-5,7-8,10-14,16,18H2,1-2H3,(H,38,39)(H,32,33,34)/t19?,20-,21?,24?/m1/s1 |
| InChIKey | ASKWPPBHHPLPMZ-ZMRATOQGSA-N |
| XLogP | 6.08 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.71 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |