C29H44N6O2 — CID 90325257
8-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]purine-2-carboxylic acid (PubChem CID 90325257) has the molecular formula C29H44N6O2 and a molecular weight of 508.71 g/mol. Its IUPAC name is 8-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]purine-2-carboxylic acid.
| Compound Name | 8-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]purine-2-carboxylic acid |
|---|---|
| PubChem CID | 90325257 |
| Molecular Formula | C29H44N6O2 |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.35 |
| IUPAC Name | 8-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]purine-2-carboxylic acid |
| SMILES | CC1CCC(Cn2c(N3CCCC4CCCCC43)nc3nc(C(=O)O)nc(N[C@H](C)C4CCC4)c32)CC1 |
| InChI | InChI=1S/C29H44N6O2/c1-18-12-14-20(15-13-18)17-35-24-25(30-19(2)21-8-5-9-21)31-27(28(36)37)32-26(24)33-29(35)34-16-6-10-22-7-3-4-11-23(22)34/h18-23H,3-17H2,1-2H3,(H,36,37)(H,30,31,32)/t18?,19-,20?,22?,23?/m1/s1 |
| InChIKey | KOJCLWPAGMFLHG-LTMODYDNSA-N |
| XLogP | 6.11 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |