About tert-butyl N-[2,2-difluoro-3-(1,8-naphthyridin-2-yl)propyl]carbamate
tert-butyl N-[2,2-difluoro-3-(1,8-naphthyridin-2-yl)propyl]carbamate (PubChem CID 90325374) has the molecular formula C16H19F2N3O2
and a molecular weight of 323.34 g/mol. Its IUPAC name is tert-butyl N-[2,2-difluoro-3-(1,8-naphthyridin-2-yl)propyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2,2-difluoro-3-(1,8-naphthyridin-2-yl)propyl]carbamate |
| PubChem CID | 90325374 |
| Molecular Formula | C16H19F2N3O2 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | tert-butyl N-[2,2-difluoro-3-(1,8-naphthyridin-2-yl)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(F)(F)Cc1ccc2cccnc2n1 |
| InChI | InChI=1S/C16H19F2N3O2/c1-15(2,3)23-14(22)20-10-16(17,18)9-12-7-6-11-5-4-8-19-13(11)21-12/h4-8H,9-10H2,1-3H3,(H,20,22) |
| InChIKey | SDPSOVACJXCEFL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[2,2-difluoro-3-(1,8-naphthyridin-2-yl)propyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2,2-difluoro-3-(1,8-naphthyridin-2-yl)propyl]carbamate?
The IUPAC name of tert-butyl N-[2,2-difluoro-3-(1,8-naphthyridin-2-yl)propyl]carbamate (CID 90325374) is tert-butyl N-[2,2-difluoro-3-(1,8-naphthyridin-2-yl)propyl]carbamate.
What is the SMILES notation for tert-butyl N-[2,2-difluoro-3-(1,8-naphthyridin-2-yl)propyl]carbamate?
The canonical SMILES for tert-butyl N-[2,2-difluoro-3-(1,8-naphthyridin-2-yl)propyl]carbamate is CC(C)(C)OC(=O)NCC(F)(F)Cc1ccc2cccnc2n1.
What is the InChIKey of tert-butyl N-[2,2-difluoro-3-(1,8-naphthyridin-2-yl)propyl]carbamate?
The InChIKey is SDPSOVACJXCEFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F2N3O2/c1-15(2,3)23-14(22)20-10-16(17,18)9-12-7-6-11-5-4-8-19-13(11)21-12/h4-8H,9-10H2,1-3H3,(H,20,22).
What are the key properties of tert-butyl N-[2,2-difluoro-3-(1,8-naphthyridin-2-yl)propyl]carbamate?
tert-butyl N-[2,2-difluoro-3-(1,8-naphthyridin-2-yl)propyl]carbamate has a molecular weight of 323.34 g/mol, XLogP of 3.33, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2,2-difluoro-3-(1,8-naphthyridin-2-yl)propyl]carbamate is sourced from PubChem (CID 90325374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).