C19H28ClN5 — CID 90325511
2-chloro-N-[(1R)-1-cyclobutylethyl]-7-[(4-methylcyclohexyl)methyl]purin-6-amine (PubChem CID 90325511) has the molecular formula C19H28ClN5 and a molecular weight of 361.92 g/mol. Its IUPAC name is 2-chloro-N-[(1R)-1-cyclobutylethyl]-7-[(4-methylcyclohexyl)methyl]purin-6-amine.
| Compound Name | 2-chloro-N-[(1R)-1-cyclobutylethyl]-7-[(4-methylcyclohexyl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 90325511 |
| Molecular Formula | C19H28ClN5 |
| Molecular Weight | 361.92 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 2-chloro-N-[(1R)-1-cyclobutylethyl]-7-[(4-methylcyclohexyl)methyl]purin-6-amine |
| SMILES | CC1CCC(Cn2cnc3nc(Cl)nc(N[C@H](C)C4CCC4)c32)CC1 |
| InChI | InChI=1S/C19H28ClN5/c1-12-6-8-14(9-7-12)10-25-11-21-17-16(25)18(24-19(20)23-17)22-13(2)15-4-3-5-15/h11-15H,3-10H2,1-2H3,(H,22,23,24)/t12?,13-,14?/m1/s1 |
| InChIKey | KALKPNUEWIBQTO-ROKHWSDSSA-N |
| XLogP | 4.91 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.92 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |