C17H17F3N2O4 — CID 90325760
N-(oxolan-3-ylmethyl)-5-[(3,4,5-trifluorophenyl)methoxymethyl]-1,2-oxazole-3-carboxamide (PubChem CID 90325760) has the molecular formula C17H17F3N2O4 and a molecular weight of 370.33 g/mol. Its IUPAC name is N-(oxolan-3-ylmethyl)-5-[(3,4,5-trifluorophenyl)methoxymethyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-(oxolan-3-ylmethyl)-5-[(3,4,5-trifluorophenyl)methoxymethyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 90325760 |
| Molecular Formula | C17H17F3N2O4 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-(oxolan-3-ylmethyl)-5-[(3,4,5-trifluorophenyl)methoxymethyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCC1CCOC1)c1cc(COCc2cc(F)c(F)c(F)c2)on1 |
| InChI | InChI=1S/C17H17F3N2O4/c18-13-3-11(4-14(19)16(13)20)8-25-9-12-5-15(22-26-12)17(23)21-6-10-1-2-24-7-10/h3-5,10H,1-2,6-9H2,(H,21,23) |
| InChIKey | NXLPGDJKZJECGM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|