C18H18F4N2O4 — CID 90325761
N-(oxolan-3-ylmethyl)-5-[(2,3,5,6-tetrafluoro-4-methylphenyl)methoxymethyl]-1,2-oxazole-3-carboxamide (PubChem CID 90325761) has the molecular formula C18H18F4N2O4 and a molecular weight of 402.34 g/mol. Its IUPAC name is N-(oxolan-3-ylmethyl)-5-[(2,3,5,6-tetrafluoro-4-methylphenyl)methoxymethyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-(oxolan-3-ylmethyl)-5-[(2,3,5,6-tetrafluoro-4-methylphenyl)methoxymethyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 90325761 |
| Molecular Formula | C18H18F4N2O4 |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-(oxolan-3-ylmethyl)-5-[(2,3,5,6-tetrafluoro-4-methylphenyl)methoxymethyl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1c(F)c(F)c(COCc2cc(C(=O)NCC3CCOC3)no2)c(F)c1F |
| InChI | InChI=1S/C18H18F4N2O4/c1-9-14(19)16(21)12(17(22)15(9)20)8-27-7-11-4-13(24-28-11)18(25)23-5-10-2-3-26-6-10/h4,10H,2-3,5-8H2,1H3,(H,23,25) |
| InChIKey | BIZQQTACCHPEFY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|