C16H15F3N2O3 — CID 90325880
N-(oxolan-3-ylmethyl)-5-[(2,3,4-trifluorophenyl)methyl]-1,2-oxazole-3-carboxamide (PubChem CID 90325880) has the molecular formula C16H15F3N2O3 and a molecular weight of 340.30 g/mol. Its IUPAC name is N-(oxolan-3-ylmethyl)-5-[(2,3,4-trifluorophenyl)methyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-(oxolan-3-ylmethyl)-5-[(2,3,4-trifluorophenyl)methyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 90325880 |
| Molecular Formula | C16H15F3N2O3 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-(oxolan-3-ylmethyl)-5-[(2,3,4-trifluorophenyl)methyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCC1CCOC1)c1cc(Cc2ccc(F)c(F)c2F)on1 |
| InChI | InChI=1S/C16H15F3N2O3/c17-12-2-1-10(14(18)15(12)19)5-11-6-13(21-24-11)16(22)20-7-9-3-4-23-8-9/h1-2,6,9H,3-5,7-8H2,(H,20,22) |
| InChIKey | JZUBPSAAHABXNQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|