C12H15Br — CID 90325905
4-bromo-1,2,7-trimethyl-2,3-dihydro-1H-indene (PubChem CID 90325905) has the molecular formula C12H15Br and a molecular weight of 239.16 g/mol. Its IUPAC name is 4-bromo-1,2,7-trimethyl-2,3-dihydro-1H-indene.
| Compound Name | 4-bromo-1,2,7-trimethyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 90325905 |
| Molecular Formula | C12H15Br |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 4-bromo-1,2,7-trimethyl-2,3-dihydro-1H-indene |
| SMILES | Cc1ccc(Br)c2c1C(C)C(C)C2 |
| InChI | InChI=1S/C12H15Br/c1-7-4-5-11(13)10-6-8(2)9(3)12(7)10/h4-5,8-9H,6H2,1-3H3 |
| InChIKey | LQTOWJNETPYSOL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |