About ethyl 5-butyl-1,2-thiazole-3-carboxylate
ethyl 5-butyl-1,2-thiazole-3-carboxylate (PubChem CID 90326186) has the molecular formula C10H15NO2S
and a molecular weight of 213.30 g/mol. Its IUPAC name is ethyl 5-butyl-1,2-thiazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-butyl-1,2-thiazole-3-carboxylate |
| PubChem CID | 90326186 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | ethyl 5-butyl-1,2-thiazole-3-carboxylate |
| SMILES | CCCCc1cc(C(=O)OCC)ns1 |
| InChI | InChI=1S/C10H15NO2S/c1-3-5-6-8-7-9(11-14-8)10(12)13-4-2/h7H,3-6H2,1-2H3 |
| InChIKey | YRJPOZUWVAUMIF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 5-butyl-1,2-thiazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-butyl-1,2-thiazole-3-carboxylate?
The IUPAC name of ethyl 5-butyl-1,2-thiazole-3-carboxylate (CID 90326186) is ethyl 5-butyl-1,2-thiazole-3-carboxylate.
What is the SMILES notation for ethyl 5-butyl-1,2-thiazole-3-carboxylate?
The canonical SMILES for ethyl 5-butyl-1,2-thiazole-3-carboxylate is CCCCc1cc(C(=O)OCC)ns1.
What is the InChIKey of ethyl 5-butyl-1,2-thiazole-3-carboxylate?
The InChIKey is YRJPOZUWVAUMIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2S/c1-3-5-6-8-7-9(11-14-8)10(12)13-4-2/h7H,3-6H2,1-2H3.
What are the key properties of ethyl 5-butyl-1,2-thiazole-3-carboxylate?
ethyl 5-butyl-1,2-thiazole-3-carboxylate has a molecular weight of 213.30 g/mol, XLogP of 2.66, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-butyl-1,2-thiazole-3-carboxylate is sourced from PubChem (CID 90326186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).