C29H31N5O5S2 — CID 90326742
3-(4-ethylsulfonylphenyl)-1-hydroxy-1-[3-[2-(2-morpholin-4-ylethyl)-4-pyridin-4-yl-1,3-thiazol-5-yl]phenyl]urea (PubChem CID 90326742) has the molecular formula C29H31N5O5S2 and a molecular weight of 593.73 g/mol. Its IUPAC name is 3-(4-ethylsulfonylphenyl)-1-hydroxy-1-[3-[2-(2-morpholin-4-ylethyl)-4-pyridin-4-yl-1,3-thiazol-5-yl]phenyl]urea.
| Compound Name | 3-(4-ethylsulfonylphenyl)-1-hydroxy-1-[3-[2-(2-morpholin-4-ylethyl)-4-pyridin-4-yl-1,3-thiazol-5-yl]phenyl]urea |
|---|---|
| PubChem CID | 90326742 |
| Molecular Formula | C29H31N5O5S2 |
| Molecular Weight | 593.73 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | 3-(4-ethylsulfonylphenyl)-1-hydroxy-1-[3-[2-(2-morpholin-4-ylethyl)-4-pyridin-4-yl-1,3-thiazol-5-yl]phenyl]urea |
| SMILES | CCS(=O)(=O)c1ccc(NC(=O)N(O)c2cccc(-c3sc(CCN4CCOCC4)nc3-c3ccncc3)c2)cc1 |
| InChI | InChI=1S/C29H31N5O5S2/c1-2-41(37,38)25-8-6-23(7-9-25)31-29(35)34(36)24-5-3-4-22(20-24)28-27(21-10-13-30-14-11-21)32-26(40-28)12-15-33-16-18-39-19-17-33/h3-11,13-14,20,36H,2,12,15-19H2,1H3,(H,31,35) |
| InChIKey | PKWCAATXDTUCFS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.73 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|