About N,N-diethyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethanamine
N,N-diethyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethanamine (PubChem CID 90327691) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is N,N-diethyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethanamine.
Molecular Properties
| Compound Name | N,N-diethyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethanamine |
| PubChem CID | 90327691 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | N,N-diethyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethanamine |
| SMILES | CCN(CC)C(C)c1nc(C)no1 |
| InChI | InChI=1S/C9H17N3O/c1-5-12(6-2)7(3)9-10-8(4)11-13-9/h7H,5-6H2,1-4H3 |
| InChIKey | YCTQOPQRWPCBFV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-diethyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethanamine?
The IUPAC name of N,N-diethyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethanamine (CID 90327691) is N,N-diethyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethanamine.
What is the SMILES notation for N,N-diethyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethanamine?
The canonical SMILES for N,N-diethyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethanamine is CCN(CC)C(C)c1nc(C)no1.
What is the InChIKey of N,N-diethyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethanamine?
The InChIKey is YCTQOPQRWPCBFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O/c1-5-12(6-2)7(3)9-10-8(4)11-13-9/h7H,5-6H2,1-4H3.
What are the key properties of N,N-diethyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethanamine?
N,N-diethyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethanamine has a molecular weight of 183.25 g/mol, XLogP of 1.78, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethanamine is sourced from PubChem (CID 90327691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).