About 3,4-dihydro-2H-1,4-thiazine-5-carboxamide
3,4-dihydro-2H-1,4-thiazine-5-carboxamide (PubChem CID 90327894) has the molecular formula C5H8N2OS
and a molecular weight of 144.20 g/mol. Its IUPAC name is 3,4-dihydro-2H-1,4-thiazine-5-carboxamide.
Molecular Properties
| Compound Name | 3,4-dihydro-2H-1,4-thiazine-5-carboxamide |
| PubChem CID | 90327894 |
| Molecular Formula | C5H8N2OS |
| Molecular Weight | 144.20 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 3,4-dihydro-2H-1,4-thiazine-5-carboxamide |
| SMILES | NC(=O)C1=CSCCN1 |
| InChI | InChI=1S/C5H8N2OS/c6-5(8)4-3-9-2-1-7-4/h3,7H,1-2H2,(H2,6,8) |
| InChIKey | UCUNHOQIJADURS-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.20 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dihydro-2H-1,4-thiazine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydro-2H-1,4-thiazine-5-carboxamide?
The IUPAC name of 3,4-dihydro-2H-1,4-thiazine-5-carboxamide (CID 90327894) is 3,4-dihydro-2H-1,4-thiazine-5-carboxamide.
What is the SMILES notation for 3,4-dihydro-2H-1,4-thiazine-5-carboxamide?
The canonical SMILES for 3,4-dihydro-2H-1,4-thiazine-5-carboxamide is NC(=O)C1=CSCCN1.
What is the InChIKey of 3,4-dihydro-2H-1,4-thiazine-5-carboxamide?
The InChIKey is UCUNHOQIJADURS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2OS/c6-5(8)4-3-9-2-1-7-4/h3,7H,1-2H2,(H2,6,8).
What are the key properties of 3,4-dihydro-2H-1,4-thiazine-5-carboxamide?
3,4-dihydro-2H-1,4-thiazine-5-carboxamide has a molecular weight of 144.20 g/mol, XLogP of -0.35, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-1,4-thiazine-5-carboxamide is sourced from PubChem (CID 90327894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).