C38H42F2N6O4 — CID 90328422
[4-fluoro-2-[5-[4-[3-(fluoromethyl)-4-methylpiperazin-1-yl]anilino]-1-methyl-6-oxo-3-pyridinyl]-6-(1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)phenyl]methyl acetate (PubChem CID 90328422) has the molecular formula C38H42F2N6O4 and a molecular weight of 684.79 g/mol. Its IUPAC name is [4-fluoro-2-[5-[4-[3-(fluoromethyl)-4-methylpiperazin-1-yl]anilino]-1-methyl-6-oxo-3-pyridinyl]-6-(1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)phenyl]methyl acetate.
| Compound Name | [4-fluoro-2-[5-[4-[3-(fluoromethyl)-4-methylpiperazin-1-yl]anilino]-1-methyl-6-oxo-3-pyridinyl]-6-(1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)phenyl]methyl acetate |
|---|---|
| PubChem CID | 90328422 |
| Molecular Formula | C38H42F2N6O4 |
| Molecular Weight | 684.79 g/mol |
| Exact Mass | 684.32 |
| IUPAC Name | [4-fluoro-2-[5-[4-[3-(fluoromethyl)-4-methylpiperazin-1-yl]anilino]-1-methyl-6-oxo-3-pyridinyl]-6-(1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)phenyl]methyl acetate |
| SMILES | CC(=O)OCc1c(-c2cc(Nc3ccc(N4CCN(C)C(CF)C4)cc3)c(=O)n(C)c2)cc(F)cc1N1CCn2c(cc3c2CCCC3)C1=O |
| InChI | InChI=1S/C38H42F2N6O4/c1-24(47)50-23-32-31(18-27(40)19-35(32)46-15-14-45-34-7-5-4-6-25(34)17-36(45)38(46)49)26-16-33(37(48)43(3)21-26)41-28-8-10-29(11-9-28)44-13-12-42(2)30(20-39)22-44/h8-11,16-19,21,30,41H,4-7,12-15,20,22-23H2,1-3H3 |
| InChIKey | ABRUGKZZUVLCHA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.79 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|