About 2-tert-butyl-1H-pyrrolo[2,3-d]pyridazine
2-tert-butyl-1H-pyrrolo[2,3-d]pyridazine (PubChem CID 90328648) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-tert-butyl-1H-pyrrolo[2,3-d]pyridazine.
Molecular Properties
| Compound Name | 2-tert-butyl-1H-pyrrolo[2,3-d]pyridazine |
| PubChem CID | 90328648 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 2-tert-butyl-1H-pyrrolo[2,3-d]pyridazine |
| SMILES | CC(C)(C)c1cc2cnncc2[nH]1 |
| InChI | InChI=1S/C10H13N3/c1-10(2,3)9-4-7-5-11-12-6-8(7)13-9/h4-6,13H,1-3H3 |
| InChIKey | NVEBCMVZQOBPML-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-1H-pyrrolo[2,3-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1H-pyrrolo[2,3-d]pyridazine?
The IUPAC name of 2-tert-butyl-1H-pyrrolo[2,3-d]pyridazine (CID 90328648) is 2-tert-butyl-1H-pyrrolo[2,3-d]pyridazine.
What is the SMILES notation for 2-tert-butyl-1H-pyrrolo[2,3-d]pyridazine?
The canonical SMILES for 2-tert-butyl-1H-pyrrolo[2,3-d]pyridazine is CC(C)(C)c1cc2cnncc2[nH]1.
What is the InChIKey of 2-tert-butyl-1H-pyrrolo[2,3-d]pyridazine?
The InChIKey is NVEBCMVZQOBPML-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-10(2,3)9-4-7-5-11-12-6-8(7)13-9/h4-6,13H,1-3H3.
What are the key properties of 2-tert-butyl-1H-pyrrolo[2,3-d]pyridazine?
2-tert-butyl-1H-pyrrolo[2,3-d]pyridazine has a molecular weight of 175.23 g/mol, XLogP of 2.26, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1H-pyrrolo[2,3-d]pyridazine is sourced from PubChem (CID 90328648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).