About N'-amino-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carbohydrazide
N'-amino-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carbohydrazide (PubChem CID 90328873) has the molecular formula C12H18N4O3
and a molecular weight of 266.30 g/mol. Its IUPAC name is N'-amino-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carbohydrazide.
Molecular Properties
| Compound Name | N'-amino-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carbohydrazide |
| PubChem CID | 90328873 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N'-amino-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carbohydrazide |
| SMILES | NNNC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C12H18N4O3/c13-15-14-12(19)9-3-1-8(2-4-9)7-16-10(17)5-6-11(16)18/h5-6,8-9,15H,1-4,7,13H2,(H,14,19) |
| InChIKey | IRKOMYPQFLUIKB-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N'-amino-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-amino-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carbohydrazide?
The IUPAC name of N'-amino-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carbohydrazide (CID 90328873) is N'-amino-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carbohydrazide.
What is the SMILES notation for N'-amino-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carbohydrazide?
The canonical SMILES for N'-amino-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carbohydrazide is NNNC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1.
What is the InChIKey of N'-amino-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carbohydrazide?
The InChIKey is IRKOMYPQFLUIKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O3/c13-15-14-12(19)9-3-1-8(2-4-9)7-16-10(17)5-6-11(16)18/h5-6,8-9,15H,1-4,7,13H2,(H,14,19).
What are the key properties of N'-amino-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carbohydrazide?
N'-amino-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carbohydrazide has a molecular weight of 266.30 g/mol, XLogP of -0.79, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-amino-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carbohydrazide is sourced from PubChem (CID 90328873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).