About 5-oxatricyclo[5.2.1.03,8]dec-1(9)-en-4-one
5-oxatricyclo[5.2.1.03,8]dec-1(9)-en-4-one (PubChem CID 90329052) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is 5-oxatricyclo[5.2.1.03,8]dec-1(9)-en-4-one.
Molecular Properties
| Compound Name | 5-oxatricyclo[5.2.1.03,8]dec-1(9)-en-4-one |
| PubChem CID | 90329052 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 5-oxatricyclo[5.2.1.03,8]dec-1(9)-en-4-one |
| SMILES | O=C1OCC2CC3=CC2C1C3 |
| InChI | InChI=1S/C9H10O2/c10-9-8-3-5-1-6(4-11-9)7(8)2-5/h2,6-8H,1,3-4H2 |
| InChIKey | CHUQEAUSDRUGJL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-oxatricyclo[5.2.1.03,8]dec-1(9)-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxatricyclo[5.2.1.03,8]dec-1(9)-en-4-one?
The IUPAC name of 5-oxatricyclo[5.2.1.03,8]dec-1(9)-en-4-one (CID 90329052) is 5-oxatricyclo[5.2.1.03,8]dec-1(9)-en-4-one.
What is the SMILES notation for 5-oxatricyclo[5.2.1.03,8]dec-1(9)-en-4-one?
The canonical SMILES for 5-oxatricyclo[5.2.1.03,8]dec-1(9)-en-4-one is O=C1OCC2CC3=CC2C1C3.
What is the InChIKey of 5-oxatricyclo[5.2.1.03,8]dec-1(9)-en-4-one?
The InChIKey is CHUQEAUSDRUGJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c10-9-8-3-5-1-6(4-11-9)7(8)2-5/h2,6-8H,1,3-4H2.
What are the key properties of 5-oxatricyclo[5.2.1.03,8]dec-1(9)-en-4-one?
5-oxatricyclo[5.2.1.03,8]dec-1(9)-en-4-one has a molecular weight of 150.18 g/mol, XLogP of 1.13, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxatricyclo[5.2.1.03,8]dec-1(9)-en-4-one is sourced from PubChem (CID 90329052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).