C8H15F5N2O6S3 — CID 90329067
N-butyl-N'-(difluoromethylsulfonyl)-1,2,3-trifluoropropane-1,3-disulfonamide (PubChem CID 90329067) has the molecular formula C8H15F5N2O6S3 and a molecular weight of 426.41 g/mol. Its IUPAC name is N-butyl-N'-(difluoromethylsulfonyl)-1,2,3-trifluoropropane-1,3-disulfonamide.
| Compound Name | N-butyl-N'-(difluoromethylsulfonyl)-1,2,3-trifluoropropane-1,3-disulfonamide |
|---|---|
| PubChem CID | 90329067 |
| Molecular Formula | C8H15F5N2O6S3 |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | N-butyl-N'-(difluoromethylsulfonyl)-1,2,3-trifluoropropane-1,3-disulfonamide |
| SMILES | CCCCNS(=O)(=O)C(F)C(F)C(F)S(=O)(=O)NS(=O)(=O)C(F)F |
| InChI | InChI=1S/C8H15F5N2O6S3/c1-2-3-4-14-22(16,17)6(10)5(9)7(11)23(18,19)15-24(20,21)8(12)13/h5-8,14-15H,2-4H2,1H3 |
| InChIKey | OQKDSCFJWNPBCN-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|