About (4-cyano-3,4-diethyl-5-oxooxolan-2-yl)methyl 2,2-dimethylbutanoate
(4-cyano-3,4-diethyl-5-oxooxolan-2-yl)methyl 2,2-dimethylbutanoate (PubChem CID 90329069) has the molecular formula C16H25NO4
and a molecular weight of 295.38 g/mol. Its IUPAC name is (4-cyano-3,4-diethyl-5-oxooxolan-2-yl)methyl 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | (4-cyano-3,4-diethyl-5-oxooxolan-2-yl)methyl 2,2-dimethylbutanoate |
| PubChem CID | 90329069 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | (4-cyano-3,4-diethyl-5-oxooxolan-2-yl)methyl 2,2-dimethylbutanoate |
| SMILES | CCC1C(COC(=O)C(C)(C)CC)OC(=O)C1(C#N)CC |
| InChI | InChI=1S/C16H25NO4/c1-6-11-12(9-20-13(18)15(4,5)7-2)21-14(19)16(11,8-3)10-17/h11-12H,6-9H2,1-5H3 |
| InChIKey | IWZGYSUDCFXUQM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-cyano-3,4-diethyl-5-oxooxolan-2-yl)methyl 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyano-3,4-diethyl-5-oxooxolan-2-yl)methyl 2,2-dimethylbutanoate?
The IUPAC name of (4-cyano-3,4-diethyl-5-oxooxolan-2-yl)methyl 2,2-dimethylbutanoate (CID 90329069) is (4-cyano-3,4-diethyl-5-oxooxolan-2-yl)methyl 2,2-dimethylbutanoate.
What is the SMILES notation for (4-cyano-3,4-diethyl-5-oxooxolan-2-yl)methyl 2,2-dimethylbutanoate?
The canonical SMILES for (4-cyano-3,4-diethyl-5-oxooxolan-2-yl)methyl 2,2-dimethylbutanoate is CCC1C(COC(=O)C(C)(C)CC)OC(=O)C1(C#N)CC.
What is the InChIKey of (4-cyano-3,4-diethyl-5-oxooxolan-2-yl)methyl 2,2-dimethylbutanoate?
The InChIKey is IWZGYSUDCFXUQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO4/c1-6-11-12(9-20-13(18)15(4,5)7-2)21-14(19)16(11,8-3)10-17/h11-12H,6-9H2,1-5H3.
What are the key properties of (4-cyano-3,4-diethyl-5-oxooxolan-2-yl)methyl 2,2-dimethylbutanoate?
(4-cyano-3,4-diethyl-5-oxooxolan-2-yl)methyl 2,2-dimethylbutanoate has a molecular weight of 295.38 g/mol, XLogP of 2.84, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyano-3,4-diethyl-5-oxooxolan-2-yl)methyl 2,2-dimethylbutanoate is sourced from PubChem (CID 90329069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).