About 3-phosphanyl-1-N,2-N-di(propan-2-yl)benzene-1,2-diamine
3-phosphanyl-1-N,2-N-di(propan-2-yl)benzene-1,2-diamine (PubChem CID 90329258) has the molecular formula C12H21N2P
and a molecular weight of 224.29 g/mol. Its IUPAC name is 3-phosphanyl-1-N,2-N-di(propan-2-yl)benzene-1,2-diamine.
Molecular Properties
| Compound Name | 3-phosphanyl-1-N,2-N-di(propan-2-yl)benzene-1,2-diamine |
| PubChem CID | 90329258 |
| Molecular Formula | C12H21N2P |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 3-phosphanyl-1-N,2-N-di(propan-2-yl)benzene-1,2-diamine |
| SMILES | CC(C)Nc1cccc(P)c1NC(C)C |
| InChI | InChI=1S/C12H21N2P/c1-8(2)13-10-6-5-7-11(15)12(10)14-9(3)4/h5-9,13-14H,15H2,1-4H3 |
| InChIKey | OTQOYICOVYXIAE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-phosphanyl-1-N,2-N-di(propan-2-yl)benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phosphanyl-1-N,2-N-di(propan-2-yl)benzene-1,2-diamine?
The IUPAC name of 3-phosphanyl-1-N,2-N-di(propan-2-yl)benzene-1,2-diamine (CID 90329258) is 3-phosphanyl-1-N,2-N-di(propan-2-yl)benzene-1,2-diamine.
What is the SMILES notation for 3-phosphanyl-1-N,2-N-di(propan-2-yl)benzene-1,2-diamine?
The canonical SMILES for 3-phosphanyl-1-N,2-N-di(propan-2-yl)benzene-1,2-diamine is CC(C)Nc1cccc(P)c1NC(C)C.
What is the InChIKey of 3-phosphanyl-1-N,2-N-di(propan-2-yl)benzene-1,2-diamine?
The InChIKey is OTQOYICOVYXIAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N2P/c1-8(2)13-10-6-5-7-11(15)12(10)14-9(3)4/h5-9,13-14H,15H2,1-4H3.
What are the key properties of 3-phosphanyl-1-N,2-N-di(propan-2-yl)benzene-1,2-diamine?
3-phosphanyl-1-N,2-N-di(propan-2-yl)benzene-1,2-diamine has a molecular weight of 224.29 g/mol, XLogP of 2.83, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phosphanyl-1-N,2-N-di(propan-2-yl)benzene-1,2-diamine is sourced from PubChem (CID 90329258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).