C14H9ClF2O3 — CID 90329310
2-chloro-5-[(2,4-difluorophenyl)methoxy]benzoic acid (PubChem CID 90329310) has the molecular formula C14H9ClF2O3 and a molecular weight of 298.67 g/mol. Its IUPAC name is 2-chloro-5-[(2,4-difluorophenyl)methoxy]benzoic acid.
| Compound Name | 2-chloro-5-[(2,4-difluorophenyl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 90329310 |
| Molecular Formula | C14H9ClF2O3 |
| Molecular Weight | 298.67 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 2-chloro-5-[(2,4-difluorophenyl)methoxy]benzoic acid |
| SMILES | O=C(O)c1cc(OCc2ccc(F)cc2F)ccc1Cl |
| InChI | InChI=1S/C14H9ClF2O3/c15-12-4-3-10(6-11(12)14(18)19)20-7-8-1-2-9(16)5-13(8)17/h1-6H,7H2,(H,18,19) |
| InChIKey | PJYZDTKRSIQGHR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.67 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |