C7H10F6 — CID 90329560
(E)-1,1,1,4,4,4-hexafluorobut-2-ene;propane (PubChem CID 90329560) has the molecular formula C7H10F6 and a molecular weight of 208.15 g/mol. Its IUPAC name is (E)-1,1,1,4,4,4-hexafluorobut-2-ene;propane.
| Compound Name | (E)-1,1,1,4,4,4-hexafluorobut-2-ene;propane |
|---|---|
| PubChem CID | 90329560 |
| Molecular Formula | C7H10F6 |
| Molecular Weight | 208.15 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (E)-1,1,1,4,4,4-hexafluorobut-2-ene;propane |
| SMILES | CCC.FC(F)(F)/C=C/C(F)(F)F |
| InChI | InChI=1S/C4H2F6.C3H8/c5-3(6,7)1-2-4(8,9)10;1-3-2/h1-2H;3H2,1-2H3/b2-1+; |
| InChIKey | BXRKKWBUXLVNIO-TYYBGVCCSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.15 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|