C25H44O6S — CID 90329927
2-(2,2,4,4,6,6,8-heptamethylnonan-5-yl)-5-hydroxy-3,4-dimethoxy-6-methylbenzenesulfonic acid (PubChem CID 90329927) has the molecular formula C25H44O6S and a molecular weight of 472.69 g/mol. Its IUPAC name is 2-(2,2,4,4,6,6,8-heptamethylnonan-5-yl)-5-hydroxy-3,4-dimethoxy-6-methylbenzenesulfonic acid.
| Compound Name | 2-(2,2,4,4,6,6,8-heptamethylnonan-5-yl)-5-hydroxy-3,4-dimethoxy-6-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 90329927 |
| Molecular Formula | C25H44O6S |
| Molecular Weight | 472.69 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | 2-(2,2,4,4,6,6,8-heptamethylnonan-5-yl)-5-hydroxy-3,4-dimethoxy-6-methylbenzenesulfonic acid |
| SMILES | COc1c(O)c(C)c(S(=O)(=O)O)c(C(C(C)(C)CC(C)C)C(C)(C)CC(C)(C)C)c1OC |
| InChI | InChI=1S/C25H44O6S/c1-15(2)13-24(7,8)22(25(9,10)14-23(4,5)6)17-19(30-11)20(31-12)18(26)16(3)21(17)32(27,28)29/h15,22,26H,13-14H2,1-12H3,(H,27,28,29) |
| InChIKey | BUYYYOSSIYEWMT-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.69 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|