C15H18BFN4O2 — CID 90329943
5-[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyrimidin-2-amine (PubChem CID 90329943) has the molecular formula C15H18BFN4O2 and a molecular weight of 316.15 g/mol. Its IUPAC name is 5-[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyrimidin-2-amine.
| Compound Name | 5-[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 90329943 |
| Molecular Formula | C15H18BFN4O2 |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 5-[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyrimidin-2-amine |
| SMILES | CC1(C)OB(c2cnc(-c3cnc(N)nc3)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C15H18BFN4O2/c1-14(2)15(3,4)23-16(22-14)10-5-11(17)12(19-8-10)9-6-20-13(18)21-7-9/h5-8H,1-4H3,(H2,18,20,21) |
| InChIKey | JUGLEWRRGJJVIT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|