C14H27N3O6 — CID 90330827
N-acetyl-6-amino-N-[(3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]hexanamide (PubChem CID 90330827) has the molecular formula C14H27N3O6 and a molecular weight of 333.39 g/mol. Its IUPAC name is N-acetyl-6-amino-N-[(3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]hexanamide.
| Compound Name | N-acetyl-6-amino-N-[(3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]hexanamide |
|---|---|
| PubChem CID | 90330827 |
| Molecular Formula | C14H27N3O6 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | N-acetyl-6-amino-N-[(3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]hexanamide |
| SMILES | CC(=O)N(C(=O)CCCCCN)C1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N |
| InChI | InChI=1S/C14H27N3O6/c1-8(19)17(10(20)5-3-2-4-6-15)14-11(16)13(22)12(21)9(7-18)23-14/h9,11-14,18,21-22H,2-7,15-16H2,1H3/t9-,11-,12-,13-,14?/m1/s1 |
| InChIKey | HREJPCKFGLJEPJ-NKLQQJLKSA-N |
| XLogP | -2.35 |
| TPSA | 159.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|