About methyl 4-[(Z)-5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hex-5-enyl]sulfanylbenzoate
methyl 4-[(Z)-5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hex-5-enyl]sulfanylbenzoate (PubChem CID 90330870) has the molecular formula C28H28F2O2S
and a molecular weight of 466.59 g/mol. Its IUPAC name is methyl 4-[(Z)-5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hex-5-enyl]sulfanylbenzoate.
Molecular Properties
| Compound Name | methyl 4-[(Z)-5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hex-5-enyl]sulfanylbenzoate |
| PubChem CID | 90330870 |
| Molecular Formula | C28H28F2O2S |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | methyl 4-[(Z)-5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hex-5-enyl]sulfanylbenzoate |
| SMILES | COC(=O)c1ccc(SCCCC/C(=C/c2ccc(C)c(C)c2)c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C28H28F2O2S/c1-19-7-8-21(14-20(19)2)15-23(24-16-25(29)18-26(30)17-24)6-4-5-13-33-27-11-9-22(10-12-27)28(31)32-3/h7-12,14-18H,4-6,13H2,1-3H3/b23-15- |
| InChIKey | XEKHPGWOKDHHBP-HAHDFKILSA-N |
| XLogP | 7.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[(Z)-5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hex-5-enyl]sulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(Z)-5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hex-5-enyl]sulfanylbenzoate?
The IUPAC name of methyl 4-[(Z)-5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hex-5-enyl]sulfanylbenzoate (CID 90330870) is methyl 4-[(Z)-5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hex-5-enyl]sulfanylbenzoate.
What is the SMILES notation for methyl 4-[(Z)-5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hex-5-enyl]sulfanylbenzoate?
The canonical SMILES for methyl 4-[(Z)-5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hex-5-enyl]sulfanylbenzoate is COC(=O)c1ccc(SCCCC/C(=C/c2ccc(C)c(C)c2)c2cc(F)cc(F)c2)cc1.
What is the InChIKey of methyl 4-[(Z)-5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hex-5-enyl]sulfanylbenzoate?
The InChIKey is XEKHPGWOKDHHBP-HAHDFKILSA-N. The full InChI is InChI=1S/C28H28F2O2S/c1-19-7-8-21(14-20(19)2)15-23(24-16-25(29)18-26(30)17-24)6-4-5-13-33-27-11-9-22(10-12-27)28(31)32-3/h7-12,14-18H,4-6,13H2,1-3H3/b23-15-.
What are the key properties of methyl 4-[(Z)-5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hex-5-enyl]sulfanylbenzoate?
methyl 4-[(Z)-5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hex-5-enyl]sulfanylbenzoate has a molecular weight of 466.59 g/mol, XLogP of 7.87, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(Z)-5-(3,5-difluorophenyl)-6-(3,4-dimethylphenyl)hex-5-enyl]sulfanylbenzoate is sourced from PubChem (CID 90330870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).