About N-[(1S,2S)-2-aminocyclopentyl]prop-2-enamide
N-[(1S,2S)-2-aminocyclopentyl]prop-2-enamide (PubChem CID 90330991) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is N-[(1S,2S)-2-aminocyclopentyl]prop-2-enamide.
Molecular Properties
| Compound Name | N-[(1S,2S)-2-aminocyclopentyl]prop-2-enamide |
| PubChem CID | 90330991 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | N-[(1S,2S)-2-aminocyclopentyl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CCC[C@@H]1N |
| InChI | InChI=1S/C8H14N2O/c1-2-8(11)10-7-5-3-4-6(7)9/h2,6-7H,1,3-5,9H2,(H,10,11)/t6-,7-/m0/s1 |
| InChIKey | WHIFKPHKKJWAJR-BQBZGAKWSA-N |
| XLogP | 0.17 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(1S,2S)-2-aminocyclopentyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S,2S)-2-aminocyclopentyl]prop-2-enamide?
The IUPAC name of N-[(1S,2S)-2-aminocyclopentyl]prop-2-enamide (CID 90330991) is N-[(1S,2S)-2-aminocyclopentyl]prop-2-enamide.
What is the SMILES notation for N-[(1S,2S)-2-aminocyclopentyl]prop-2-enamide?
The canonical SMILES for N-[(1S,2S)-2-aminocyclopentyl]prop-2-enamide is C=CC(=O)N[C@H]1CCC[C@@H]1N.
What is the InChIKey of N-[(1S,2S)-2-aminocyclopentyl]prop-2-enamide?
The InChIKey is WHIFKPHKKJWAJR-BQBZGAKWSA-N. The full InChI is InChI=1S/C8H14N2O/c1-2-8(11)10-7-5-3-4-6(7)9/h2,6-7H,1,3-5,9H2,(H,10,11)/t6-,7-/m0/s1.
What are the key properties of N-[(1S,2S)-2-aminocyclopentyl]prop-2-enamide?
N-[(1S,2S)-2-aminocyclopentyl]prop-2-enamide has a molecular weight of 154.21 g/mol, XLogP of 0.17, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S,2S)-2-aminocyclopentyl]prop-2-enamide is sourced from PubChem (CID 90330991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).