C19H23ClN6O3S — CID 90331211
N-[2-[[5-chloro-2-[[(3S)-1-methylsulfonylpiperidin-3-yl]amino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 90331211) has the molecular formula C19H23ClN6O3S and a molecular weight of 450.95 g/mol. Its IUPAC name is N-[2-[[5-chloro-2-[[(3S)-1-methylsulfonylpiperidin-3-yl]amino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[[5-chloro-2-[[(3S)-1-methylsulfonylpiperidin-3-yl]amino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 90331211 |
| Molecular Formula | C19H23ClN6O3S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | N-[2-[[5-chloro-2-[[(3S)-1-methylsulfonylpiperidin-3-yl]amino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1nc(N[C@H]2CCCN(S(C)(=O)=O)C2)ncc1Cl |
| InChI | InChI=1S/C19H23ClN6O3S/c1-3-17(27)23-15-8-4-5-9-16(15)24-18-14(20)11-21-19(25-18)22-13-7-6-10-26(12-13)30(2,28)29/h3-5,8-9,11,13H,1,6-7,10,12H2,2H3,(H,23,27)(H2,21,22,24,25)/t13-/m0/s1 |
| InChIKey | HYVNYDUQTCIFNS-ZDUSSCGKSA-N |
| XLogP | 2.83 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|