C23H22F3N5O2 — CID 90331330
N-[2-[[2-(5-methoxy-2-methylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]-5-methylphenyl]prop-2-enamide (PubChem CID 90331330) has the molecular formula C23H22F3N5O2 and a molecular weight of 457.46 g/mol. Its IUPAC name is N-[2-[[2-(5-methoxy-2-methylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]-5-methylphenyl]prop-2-enamide.
| Compound Name | N-[2-[[2-(5-methoxy-2-methylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]-5-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 90331330 |
| Molecular Formula | C23H22F3N5O2 |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | N-[2-[[2-(5-methoxy-2-methylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]-5-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(C)ccc1Nc1nc(Nc2cc(OC)ccc2C)ncc1C(F)(F)F |
| InChI | InChI=1S/C23H22F3N5O2/c1-5-20(32)28-19-10-13(2)6-9-17(19)29-21-16(23(24,25)26)12-27-22(31-21)30-18-11-15(33-4)8-7-14(18)3/h5-12H,1H2,2-4H3,(H,28,32)(H2,27,29,30,31) |
| InChIKey | PCTZXYCJBXUGJJ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|