C23H20F4N6O2 — CID 90331352
2-fluoro-N,4-dimethyl-5-[[4-[2-(prop-2-enoylamino)anilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzamide (PubChem CID 90331352) has the molecular formula C23H20F4N6O2 and a molecular weight of 488.45 g/mol. Its IUPAC name is 2-fluoro-N,4-dimethyl-5-[[4-[2-(prop-2-enoylamino)anilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzamide.
| Compound Name | 2-fluoro-N,4-dimethyl-5-[[4-[2-(prop-2-enoylamino)anilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 90331352 |
| Molecular Formula | C23H20F4N6O2 |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 2-fluoro-N,4-dimethyl-5-[[4-[2-(prop-2-enoylamino)anilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1nc(Nc2cc(C(=O)NC)c(F)cc2C)ncc1C(F)(F)F |
| InChI | InChI=1S/C23H20F4N6O2/c1-4-19(34)30-16-7-5-6-8-17(16)31-20-14(23(25,26)27)11-29-22(33-20)32-18-10-13(21(35)28-3)15(24)9-12(18)2/h4-11H,1H2,2-3H3,(H,28,35)(H,30,34)(H2,29,31,32,33) |
| InChIKey | MPTHHVCKJMXTEU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|