C21H24F3N7O2 — CID 90331489
3-[[2-[[(3S)-1-acetylpiperidin-3-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N-cyanobicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 90331489) has the molecular formula C21H24F3N7O2 and a molecular weight of 463.46 g/mol. Its IUPAC name is 3-[[2-[[(3S)-1-acetylpiperidin-3-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N-cyanobicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | 3-[[2-[[(3S)-1-acetylpiperidin-3-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N-cyanobicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 90331489 |
| Molecular Formula | C21H24F3N7O2 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 3-[[2-[[(3S)-1-acetylpiperidin-3-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N-cyanobicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CC(=O)N1CCC[C@H](Nc2ncc(C(F)(F)F)c(NC3C4C=CC(C4)C3C(=O)NC#N)n2)C1 |
| InChI | InChI=1S/C21H24F3N7O2/c1-11(32)31-6-2-3-14(9-31)28-20-26-8-15(21(22,23)24)18(30-20)29-17-13-5-4-12(7-13)16(17)19(33)27-10-25/h4-5,8,12-14,16-17H,2-3,6-7,9H2,1H3,(H,27,33)(H2,26,28,29,30)/t12?,13?,14-,16?,17?/m0/s1 |
| InChIKey | BLYXFODVZMOWKX-XWTIBIIYSA-N |
| XLogP | 2.12 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|