C30H32ClNO3 — CID 90332091
1-[[4-[(Z)-4-(3-chlorophenyl)-5-(3,4-dimethylphenyl)pent-4-enoxy]phenyl]methyl]azetidine-3-carboxylic acid (PubChem CID 90332091) has the molecular formula C30H32ClNO3 and a molecular weight of 490.04 g/mol. Its IUPAC name is 1-[[4-[(Z)-4-(3-chlorophenyl)-5-(3,4-dimethylphenyl)pent-4-enoxy]phenyl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[4-[(Z)-4-(3-chlorophenyl)-5-(3,4-dimethylphenyl)pent-4-enoxy]phenyl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 90332091 |
| Molecular Formula | C30H32ClNO3 |
| Molecular Weight | 490.04 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 1-[[4-[(Z)-4-(3-chlorophenyl)-5-(3,4-dimethylphenyl)pent-4-enoxy]phenyl]methyl]azetidine-3-carboxylic acid |
| SMILES | Cc1ccc(/C=C(/CCCOc2ccc(CN3CC(C(=O)O)C3)cc2)c2cccc(Cl)c2)cc1C |
| InChI | InChI=1S/C30H32ClNO3/c1-21-8-9-24(15-22(21)2)16-25(26-5-3-7-28(31)17-26)6-4-14-35-29-12-10-23(11-13-29)18-32-19-27(20-32)30(33)34/h3,5,7-13,15-17,27H,4,6,14,18-20H2,1-2H3,(H,33,34)/b25-16- |
| InChIKey | VDOAVYLNRPWXRO-XYGWBWBKSA-N |
| XLogP | 6.87 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.04 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|