About 3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]propyl N-(4-amino-2-fluorophenyl)carbamate
3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]propyl N-(4-amino-2-fluorophenyl)carbamate (PubChem CID 90332851) has the molecular formula C21H24FN5O2S
and a molecular weight of 429.52 g/mol. Its IUPAC name is 3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]propyl N-(4-amino-2-fluorophenyl)carbamate.
Molecular Properties
| Compound Name | 3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]propyl N-(4-amino-2-fluorophenyl)carbamate |
| PubChem CID | 90332851 |
| Molecular Formula | C21H24FN5O2S |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]propyl N-(4-amino-2-fluorophenyl)carbamate |
| SMILES | Nc1ccc(NC(=O)OCCCN2CCN(c3nc4ccccc4s3)CC2)c(F)c1 |
| InChI | InChI=1S/C21H24FN5O2S/c22-16-14-15(23)6-7-17(16)25-21(28)29-13-3-8-26-9-11-27(12-10-26)20-24-18-4-1-2-5-19(18)30-20/h1-2,4-7,14H,3,8-13,23H2,(H,25,28) |
| InChIKey | MUYDTKDEKHVRMQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]propyl N-(4-amino-2-fluorophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]propyl N-(4-amino-2-fluorophenyl)carbamate?
The IUPAC name of 3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]propyl N-(4-amino-2-fluorophenyl)carbamate (CID 90332851) is 3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]propyl N-(4-amino-2-fluorophenyl)carbamate.
What is the SMILES notation for 3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]propyl N-(4-amino-2-fluorophenyl)carbamate?
The canonical SMILES for 3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]propyl N-(4-amino-2-fluorophenyl)carbamate is Nc1ccc(NC(=O)OCCCN2CCN(c3nc4ccccc4s3)CC2)c(F)c1.
What is the InChIKey of 3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]propyl N-(4-amino-2-fluorophenyl)carbamate?
The InChIKey is MUYDTKDEKHVRMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24FN5O2S/c22-16-14-15(23)6-7-17(16)25-21(28)29-13-3-8-26-9-11-27(12-10-26)20-24-18-4-1-2-5-19(18)30-20/h1-2,4-7,14H,3,8-13,23H2,(H,25,28).
What are the key properties of 3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]propyl N-(4-amino-2-fluorophenyl)carbamate?
3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]propyl N-(4-amino-2-fluorophenyl)carbamate has a molecular weight of 429.52 g/mol, XLogP of 3.78, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(1,3-benzothiazol-2-yl)piperazin-1-yl]propyl N-(4-amino-2-fluorophenyl)carbamate is sourced from PubChem (CID 90332851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).