About 2-[4-[(2,6-diaminopurin-9-yl)methyl]phenyl]phenol
2-[4-[(2,6-diaminopurin-9-yl)methyl]phenyl]phenol (PubChem CID 90332954) has the molecular formula C18H16N6O
and a molecular weight of 332.37 g/mol. Its IUPAC name is 2-[4-[(2,6-diaminopurin-9-yl)methyl]phenyl]phenol.
Molecular Properties
| Compound Name | 2-[4-[(2,6-diaminopurin-9-yl)methyl]phenyl]phenol |
| PubChem CID | 90332954 |
| Molecular Formula | C18H16N6O |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 2-[4-[(2,6-diaminopurin-9-yl)methyl]phenyl]phenol |
| SMILES | Nc1nc(N)c2ncn(Cc3ccc(-c4ccccc4O)cc3)c2n1 |
| InChI | InChI=1S/C18H16N6O/c19-16-15-17(23-18(20)22-16)24(10-21-15)9-11-5-7-12(8-6-11)13-3-1-2-4-14(13)25/h1-8,10,25H,9H2,(H4,19,20,22,23) |
| InChIKey | JXXODQXRWJCRGS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4-[(2,6-diaminopurin-9-yl)methyl]phenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(2,6-diaminopurin-9-yl)methyl]phenyl]phenol?
The IUPAC name of 2-[4-[(2,6-diaminopurin-9-yl)methyl]phenyl]phenol (CID 90332954) is 2-[4-[(2,6-diaminopurin-9-yl)methyl]phenyl]phenol.
What is the SMILES notation for 2-[4-[(2,6-diaminopurin-9-yl)methyl]phenyl]phenol?
The canonical SMILES for 2-[4-[(2,6-diaminopurin-9-yl)methyl]phenyl]phenol is Nc1nc(N)c2ncn(Cc3ccc(-c4ccccc4O)cc3)c2n1.
What is the InChIKey of 2-[4-[(2,6-diaminopurin-9-yl)methyl]phenyl]phenol?
The InChIKey is JXXODQXRWJCRGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N6O/c19-16-15-17(23-18(20)22-16)24(10-21-15)9-11-5-7-12(8-6-11)13-3-1-2-4-14(13)25/h1-8,10,25H,9H2,(H4,19,20,22,23).
What are the key properties of 2-[4-[(2,6-diaminopurin-9-yl)methyl]phenyl]phenol?
2-[4-[(2,6-diaminopurin-9-yl)methyl]phenyl]phenol has a molecular weight of 332.37 g/mol, XLogP of 2.41, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2,6-diaminopurin-9-yl)methyl]phenyl]phenol is sourced from PubChem (CID 90332954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).