About CID 90333242
CID 90333242 (PubChem CID 90333242) has the molecular formula C5H14FNO3S
and a molecular weight of 187.24 g/mol.
Molecular Properties
| Compound Name | CID 90333242 |
| PubChem CID | 90333242 |
| Molecular Formula | C5H14FNO3S |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | — |
| SMILES | CC[N+](C)(C)C.O=S(=O)([O-])F |
| InChI | InChI=1S/C5H14N.FHO3S/c1-5-6(2,3)4;1-5(2,3)4/h5H2,1-4H3;(H,2,3,4)/q+1;/p-1 |
| InChIKey | LBUVAAWZYRMPIO-UHFFFAOYSA-M |
| XLogP | 0.13 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 90333242 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90333242?
The IUPAC name of CID 90333242 (CID 90333242) is not available.
What is the SMILES notation for CID 90333242?
The canonical SMILES for CID 90333242 is CC[N+](C)(C)C.O=S(=O)([O-])F.
What is the InChIKey of CID 90333242?
The InChIKey is LBUVAAWZYRMPIO-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H14N.FHO3S/c1-5-6(2,3)4;1-5(2,3)4/h5H2,1-4H3;(H,2,3,4)/q+1;/p-1.
What are the key properties of CID 90333242?
CID 90333242 has a molecular weight of 187.24 g/mol, XLogP of 0.13, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90333242 is sourced from PubChem (CID 90333242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).