C25H28F3N7O5 — CID 90333831
2-[[3-[4-[[4-[(4-hydroxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]anilino]-2,2-dimethylpropyl]amino]-2-oxoacetic acid (PubChem CID 90333831) has the molecular formula C25H28F3N7O5 and a molecular weight of 563.54 g/mol. Its IUPAC name is 2-[[3-[4-[[4-[(4-hydroxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]anilino]-2,2-dimethylpropyl]amino]-2-oxoacetic acid.
| Compound Name | 2-[[3-[4-[[4-[(4-hydroxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]anilino]-2,2-dimethylpropyl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 90333831 |
| Molecular Formula | C25H28F3N7O5 |
| Molecular Weight | 563.54 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | 2-[[3-[4-[[4-[(4-hydroxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]anilino]-2,2-dimethylpropyl]amino]-2-oxoacetic acid |
| SMILES | CC(C)(CNC(=O)C(=O)O)CNc1ccc(Nc2nc(NCc3ccc(O)cc3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C25H28F3N7O5/c1-24(2,13-31-19(37)20(38)39)12-30-16-5-7-17(8-6-16)32-22-33-21(29-11-15-3-9-18(36)10-4-15)34-23(35-22)40-14-25(26,27)28/h3-10,30,36H,11-14H2,1-2H3,(H,31,37)(H,38,39)(H2,29,32,33,34,35) |
| InChIKey | RWUMLHAEKBOODR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 170.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|