C10H5BrF8N4 — CID 90333952
5-(4-bromopyrazol-1-yl)-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole (PubChem CID 90333952) has the molecular formula C10H5BrF8N4 and a molecular weight of 413.07 g/mol. Its IUPAC name is 5-(4-bromopyrazol-1-yl)-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole.
| Compound Name | 5-(4-bromopyrazol-1-yl)-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 90333952 |
| Molecular Formula | C10H5BrF8N4 |
| Molecular Weight | 413.07 g/mol |
| Exact Mass | 411.96 |
| IUPAC Name | 5-(4-bromopyrazol-1-yl)-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole |
| SMILES | Cn1nc(C(F)(F)C(F)(F)F)c(C(F)(F)F)c1-n1cc(Br)cn1 |
| InChI | InChI=1S/C10H5BrF8N4/c1-22-7(23-3-4(11)2-20-23)5(9(14,15)16)6(21-22)8(12,13)10(17,18)19/h2-3H,1H3 |
| InChIKey | FJVPSOPCFRAJEF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.07 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|