About 5-(1-iminopropan-2-yl)-1,3,4-thiadiazol-2-amine
5-(1-iminopropan-2-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 90334340) has the molecular formula C5H8N4S
and a molecular weight of 156.21 g/mol. Its IUPAC name is 5-(1-iminopropan-2-yl)-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | 5-(1-iminopropan-2-yl)-1,3,4-thiadiazol-2-amine |
| PubChem CID | 90334340 |
| Molecular Formula | C5H8N4S |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 5-(1-iminopropan-2-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | [H]/N=C/C(C)c1nnc(N)s1 |
| InChI | InChI=1S/C5H8N4S/c1-3(2-6)4-8-9-5(7)10-4/h2-3,6H,1H3,(H2,7,9)/b6-2+ |
| InChIKey | XVTCWBNTEXTWKM-QHHAFSJGSA-N |
| XLogP | 0.87 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-iminopropan-2-yl)-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-iminopropan-2-yl)-1,3,4-thiadiazol-2-amine?
The IUPAC name of 5-(1-iminopropan-2-yl)-1,3,4-thiadiazol-2-amine (CID 90334340) is 5-(1-iminopropan-2-yl)-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for 5-(1-iminopropan-2-yl)-1,3,4-thiadiazol-2-amine?
The canonical SMILES for 5-(1-iminopropan-2-yl)-1,3,4-thiadiazol-2-amine is [H]/N=C/C(C)c1nnc(N)s1.
What is the InChIKey of 5-(1-iminopropan-2-yl)-1,3,4-thiadiazol-2-amine?
The InChIKey is XVTCWBNTEXTWKM-QHHAFSJGSA-N. The full InChI is InChI=1S/C5H8N4S/c1-3(2-6)4-8-9-5(7)10-4/h2-3,6H,1H3,(H2,7,9)/b6-2+.
What are the key properties of 5-(1-iminopropan-2-yl)-1,3,4-thiadiazol-2-amine?
5-(1-iminopropan-2-yl)-1,3,4-thiadiazol-2-amine has a molecular weight of 156.21 g/mol, XLogP of 0.87, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-iminopropan-2-yl)-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 90334340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).